C27H22N2O8 — CID 161129264
[3-(2,5-dioxopyrrol-1-yl)phenyl] 2-methylprop-2-enoate;[4-(3-methyl-2,5-dioxopyrrol-1-yl)phenyl] acetate (PubChem CID 161129264) has the molecular formula C27H22N2O8 and a molecular weight of 502.48 g/mol. Its IUPAC name is [3-(2,5-dioxopyrrol-1-yl)phenyl] 2-methylprop-2-enoate;[4-(3-methyl-2,5-dioxopyrrol-1-yl)phenyl] acetate.
| Compound Name | [3-(2,5-dioxopyrrol-1-yl)phenyl] 2-methylprop-2-enoate;[4-(3-methyl-2,5-dioxopyrrol-1-yl)phenyl] acetate |
|---|---|
| PubChem CID | 161129264 |
| Molecular Formula | C27H22N2O8 |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | [3-(2,5-dioxopyrrol-1-yl)phenyl] 2-methylprop-2-enoate;[4-(3-methyl-2,5-dioxopyrrol-1-yl)phenyl] acetate |
| SMILES | C=C(C)C(=O)Oc1cccc(N2C(=O)C=CC2=O)c1.CC(=O)Oc1ccc(N2C(=O)C=C(C)C2=O)cc1 |
| InChI | InChI=1S/C14H11NO4.C13H11NO4/c1-9(2)14(18)19-11-5-3-4-10(8-11)15-12(16)6-7-13(15)17;1-8-7-12(16)14(13(8)17)10-3-5-11(6-4-10)18-9(2)15/h3-8H,1H2,2H3;3-7H,1-2H3 |
| InChIKey | ULYULPNMRHVFNV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|