C16H7Br4NO4 — CID 21239852
[4-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)phenyl] acetate (PubChem CID 21239852) has the molecular formula C16H7Br4NO4 and a molecular weight of 596.85 g/mol. Its IUPAC name is [4-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)phenyl] acetate.
| Compound Name | [4-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)phenyl] acetate |
|---|---|
| PubChem CID | 21239852 |
| Molecular Formula | C16H7Br4NO4 |
| Molecular Weight | 596.85 g/mol |
| Exact Mass | 592.71 |
| IUPAC Name | [4-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(N2C(=O)c3c(Br)c(Br)c(Br)c(Br)c3C2=O)cc1 |
| InChI | InChI=1S/C16H7Br4NO4/c1-6(22)25-8-4-2-7(3-5-8)21-15(23)9-10(16(21)24)12(18)14(20)13(19)11(9)17/h2-5H,1H3 |
| InChIKey | HPBOLYXPPDHFLB-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.85 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|