C22H21Br4NO2S — CID 88891378
4,5,6,7-tetrabromo-2-(4-octoxyphenyl)-3-sulfanylideneisoindol-1-one (PubChem CID 88891378) has the molecular formula C22H21Br4NO2S and a molecular weight of 683.10 g/mol. Its IUPAC name is 4,5,6,7-tetrabromo-2-(4-octoxyphenyl)-3-sulfanylideneisoindol-1-one.
| Compound Name | 4,5,6,7-tetrabromo-2-(4-octoxyphenyl)-3-sulfanylideneisoindol-1-one |
|---|---|
| PubChem CID | 88891378 |
| Molecular Formula | C22H21Br4NO2S |
| Molecular Weight | 683.10 g/mol |
| Exact Mass | 678.80 |
| IUPAC Name | 4,5,6,7-tetrabromo-2-(4-octoxyphenyl)-3-sulfanylideneisoindol-1-one |
| SMILES | CCCCCCCCOc1ccc(N2C(=O)c3c(Br)c(Br)c(Br)c(Br)c3C2=S)cc1 |
| InChI | InChI=1S/C22H21Br4NO2S/c1-2-3-4-5-6-7-12-29-14-10-8-13(9-11-14)27-21(28)15-16(22(27)30)18(24)20(26)19(25)17(15)23/h8-11H,2-7,12H2,1H3 |
| InChIKey | VVIXOBBMNSDMAE-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.10 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|