C16H15NO4 — CID 4970036
[4-(3-but-2-enylidene-2,5-dioxopyrrolidin-1-yl)phenyl] acetate (PubChem CID 4970036) has the molecular formula C16H15NO4 and a molecular weight of 285.30 g/mol. Its IUPAC name is [4-(3-but-2-enylidene-2,5-dioxopyrrolidin-1-yl)phenyl] acetate.
| Compound Name | [4-(3-but-2-enylidene-2,5-dioxopyrrolidin-1-yl)phenyl] acetate |
|---|---|
| PubChem CID | 4970036 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | [4-(3-but-2-enylidene-2,5-dioxopyrrolidin-1-yl)phenyl] acetate |
| SMILES | CC=CC=C1CC(=O)N(c2ccc(OC(C)=O)cc2)C1=O |
| InChI | InChI=1S/C16H15NO4/c1-3-4-5-12-10-15(19)17(16(12)20)13-6-8-14(9-7-13)21-11(2)18/h3-9H,10H2,1-2H3 |
| InChIKey | NCJMNZBICZRFNV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|