C8H4F2I2O6S — CID 174250302
1,1-difluoro-2-(4-hydroxy-3,5-diiodophenoxy)-2-oxoethanesulfonic acid (PubChem CID 174250302) has the molecular formula C8H4F2I2O6S and a molecular weight of 519.99 g/mol. Its IUPAC name is 1,1-difluoro-2-(4-hydroxy-3,5-diiodophenoxy)-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-(4-hydroxy-3,5-diiodophenoxy)-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 174250302 |
| Molecular Formula | C8H4F2I2O6S |
| Molecular Weight | 519.99 g/mol |
| Exact Mass | 519.78 |
| IUPAC Name | 1,1-difluoro-2-(4-hydroxy-3,5-diiodophenoxy)-2-oxoethanesulfonic acid |
| SMILES | O=C(Oc1cc(I)c(O)c(I)c1)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C8H4F2I2O6S/c9-8(10,19(15,16)17)7(14)18-3-1-4(11)6(13)5(12)2-3/h1-2,13H,(H,15,16,17) |
| InChIKey | TWZYDULUQAMKAZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.99 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|