C10H3F6IO4 — CID 101128804
[3-iodo-5-(2,2,2-trifluoroacetyl)oxyphenyl] 2,2,2-trifluoroacetate (PubChem CID 101128804) has the molecular formula C10H3F6IO4 and a molecular weight of 428.02 g/mol. Its IUPAC name is [3-iodo-5-(2,2,2-trifluoroacetyl)oxyphenyl] 2,2,2-trifluoroacetate.
| Compound Name | [3-iodo-5-(2,2,2-trifluoroacetyl)oxyphenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 101128804 |
| Molecular Formula | C10H3F6IO4 |
| Molecular Weight | 428.02 g/mol |
| Exact Mass | 427.90 |
| IUPAC Name | [3-iodo-5-(2,2,2-trifluoroacetyl)oxyphenyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(Oc1cc(I)cc(OC(=O)C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C10H3F6IO4/c11-9(12,13)7(18)20-5-1-4(17)2-6(3-5)21-8(19)10(14,15)16/h1-3H |
| InChIKey | ANRBSVZESHYELZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.02 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|