C10H8F3NO4 — CID 130231940
(3-acetyloxy-5-aminophenyl) 2,2,2-trifluoroacetate (PubChem CID 130231940) has the molecular formula C10H8F3NO4 and a molecular weight of 263.17 g/mol. Its IUPAC name is (3-acetyloxy-5-aminophenyl) 2,2,2-trifluoroacetate.
| Compound Name | (3-acetyloxy-5-aminophenyl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 130231940 |
| Molecular Formula | C10H8F3NO4 |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | (3-acetyloxy-5-aminophenyl) 2,2,2-trifluoroacetate |
| SMILES | CC(=O)Oc1cc(N)cc(OC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H8F3NO4/c1-5(15)17-7-2-6(14)3-8(4-7)18-9(16)10(11,12)13/h2-4H,14H2,1H3 |
| InChIKey | JSDIAPXXCSAGQL-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|