C20H14F6I2O9 — CID 10898005
[(4-acetyloxyphenyl)-[(4-acetyloxyphenyl)-(2,2,2-trifluoroacetyl)oxy-λ3-iodanyl]oxy-λ3-iodanyl] 2,2,2-trifluoroacetate (PubChem CID 10898005) has the molecular formula C20H14F6I2O9 and a molecular weight of 766.12 g/mol. Its IUPAC name is [(4-acetyloxyphenyl)-[(4-acetyloxyphenyl)-(2,2,2-trifluoroacetyl)oxy-λ3-iodanyl]oxy-λ3-iodanyl] 2,2,2-trifluoroacetate.
| Compound Name | [(4-acetyloxyphenyl)-[(4-acetyloxyphenyl)-(2,2,2-trifluoroacetyl)oxy-λ3-iodanyl]oxy-λ3-iodanyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 10898005 |
| Molecular Formula | C20H14F6I2O9 |
| Molecular Weight | 766.12 g/mol |
| Exact Mass | 765.86 |
| IUPAC Name | [(4-acetyloxyphenyl)-[(4-acetyloxyphenyl)-(2,2,2-trifluoroacetyl)oxy-λ3-iodanyl]oxy-λ3-iodanyl] 2,2,2-trifluoroacetate |
| SMILES | CC(=O)Oc1ccc(I(OC(=O)C(F)(F)F)OI(OC(=O)C(F)(F)F)c2ccc(OC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C20H14F6I2O9/c1-11(29)33-15-7-3-13(4-8-15)27(35-17(31)19(21,22)23)37-28(36-18(32)20(24,25)26)14-5-9-16(10-6-14)34-12(2)30/h3-10H,1-2H3 |
| InChIKey | WTCMIADCVIKHQQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.12 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|