About 2,2-dimethylpropanoyl 3,5-diacetyloxybenzoate
2,2-dimethylpropanoyl 3,5-diacetyloxybenzoate (PubChem CID 101248297) has the molecular formula C16H18O7
and a molecular weight of 322.31 g/mol. Its IUPAC name is 2,2-dimethylpropanoyl 3,5-diacetyloxybenzoate.
Molecular Properties
| Compound Name | 2,2-dimethylpropanoyl 3,5-diacetyloxybenzoate |
| PubChem CID | 101248297 |
| Molecular Formula | C16H18O7 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 2,2-dimethylpropanoyl 3,5-diacetyloxybenzoate |
| SMILES | CC(=O)Oc1cc(OC(C)=O)cc(C(=O)OC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C16H18O7/c1-9(17)21-12-6-11(7-13(8-12)22-10(2)18)14(19)23-15(20)16(3,4)5/h6-8H,1-5H3 |
| InChIKey | SLLYBQCNAHUSET-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethylpropanoyl 3,5-diacetyloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropanoyl 3,5-diacetyloxybenzoate?
The IUPAC name of 2,2-dimethylpropanoyl 3,5-diacetyloxybenzoate (CID 101248297) is 2,2-dimethylpropanoyl 3,5-diacetyloxybenzoate.
What is the SMILES notation for 2,2-dimethylpropanoyl 3,5-diacetyloxybenzoate?
The canonical SMILES for 2,2-dimethylpropanoyl 3,5-diacetyloxybenzoate is CC(=O)Oc1cc(OC(C)=O)cc(C(=O)OC(=O)C(C)(C)C)c1.
What is the InChIKey of 2,2-dimethylpropanoyl 3,5-diacetyloxybenzoate?
The InChIKey is SLLYBQCNAHUSET-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O7/c1-9(17)21-12-6-11(7-13(8-12)22-10(2)18)14(19)23-15(20)16(3,4)5/h6-8H,1-5H3.
What are the key properties of 2,2-dimethylpropanoyl 3,5-diacetyloxybenzoate?
2,2-dimethylpropanoyl 3,5-diacetyloxybenzoate has a molecular weight of 322.31 g/mol, XLogP of 2.27, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropanoyl 3,5-diacetyloxybenzoate is sourced from PubChem (CID 101248297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).