C15H16F8O7S — CID 121360604
1,1-difluoro-2-[1,1,1,3,3,3-hexafluoro-2-[1-(2-methylprop-2-enoyloxy)cyclohexyl]propan-2-yl]oxy-2-oxoethanesulfonic acid (PubChem CID 121360604) has the molecular formula C15H16F8O7S and a molecular weight of 492.34 g/mol. Its IUPAC name is 1,1-difluoro-2-[1,1,1,3,3,3-hexafluoro-2-[1-(2-methylprop-2-enoyloxy)cyclohexyl]propan-2-yl]oxy-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[1,1,1,3,3,3-hexafluoro-2-[1-(2-methylprop-2-enoyloxy)cyclohexyl]propan-2-yl]oxy-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 121360604 |
| Molecular Formula | C15H16F8O7S |
| Molecular Weight | 492.34 g/mol |
| Exact Mass | 492.05 |
| IUPAC Name | 1,1-difluoro-2-[1,1,1,3,3,3-hexafluoro-2-[1-(2-methylprop-2-enoyloxy)cyclohexyl]propan-2-yl]oxy-2-oxoethanesulfonic acid |
| SMILES | C=C(C)C(=O)OC1(C(OC(=O)C(F)(F)S(=O)(=O)O)(C(F)(F)F)C(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C15H16F8O7S/c1-8(2)9(24)29-11(6-4-3-5-7-11)13(14(18,19)20,15(21,22)23)30-10(25)12(16,17)31(26,27)28/h1,3-7H2,2H3,(H,26,27,28) |
| InChIKey | WXCUDKUCRNITSN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|