C13H15F7O2 — CID 130411163
[1-(2,2,3,3,4,4,4-heptafluorobutyl)cyclopentyl] 2-methylprop-2-enoate (PubChem CID 130411163) has the molecular formula C13H15F7O2 and a molecular weight of 336.25 g/mol. Its IUPAC name is [1-(2,2,3,3,4,4,4-heptafluorobutyl)cyclopentyl] 2-methylprop-2-enoate.
| Compound Name | [1-(2,2,3,3,4,4,4-heptafluorobutyl)cyclopentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 130411163 |
| Molecular Formula | C13H15F7O2 |
| Molecular Weight | 336.25 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | [1-(2,2,3,3,4,4,4-heptafluorobutyl)cyclopentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(CC(F)(F)C(F)(F)C(F)(F)F)CCCC1 |
| InChI | InChI=1S/C13H15F7O2/c1-8(2)9(21)22-10(5-3-4-6-10)7-11(14,15)12(16,17)13(18,19)20/h1,3-7H2,2H3 |
| InChIKey | FHVKTAGLFNJMSM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.25 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|