C17H27F5O3Si — CID 58995526
[1-(1,1,3,3,3-pentafluoro-2-methyl-2-trimethylsilyloxypropyl)cyclohexyl] 2-methylprop-2-enoate (PubChem CID 58995526) has the molecular formula C17H27F5O3Si and a molecular weight of 402.48 g/mol. Its IUPAC name is [1-(1,1,3,3,3-pentafluoro-2-methyl-2-trimethylsilyloxypropyl)cyclohexyl] 2-methylprop-2-enoate.
| Compound Name | [1-(1,1,3,3,3-pentafluoro-2-methyl-2-trimethylsilyloxypropyl)cyclohexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58995526 |
| Molecular Formula | C17H27F5O3Si |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | [1-(1,1,3,3,3-pentafluoro-2-methyl-2-trimethylsilyloxypropyl)cyclohexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(C(F)(F)C(C)(O[Si](C)(C)C)C(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C17H27F5O3Si/c1-12(2)13(23)24-15(10-8-7-9-11-15)16(18,19)14(3,17(20,21)22)25-26(4,5)6/h1,7-11H2,2-6H3 |
| InChIKey | MNKDZPDKQOCEKV-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|