C17H26F2O5 — CID 157484794
2,2-difluoropropyl 4-hydroxy-4-[1-(2-methylprop-2-enoyloxy)cyclohexyl]butanoate (PubChem CID 157484794) has the molecular formula C17H26F2O5 and a molecular weight of 348.39 g/mol. Its IUPAC name is 2,2-difluoropropyl 4-hydroxy-4-[1-(2-methylprop-2-enoyloxy)cyclohexyl]butanoate.
| Compound Name | 2,2-difluoropropyl 4-hydroxy-4-[1-(2-methylprop-2-enoyloxy)cyclohexyl]butanoate |
|---|---|
| PubChem CID | 157484794 |
| Molecular Formula | C17H26F2O5 |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2,2-difluoropropyl 4-hydroxy-4-[1-(2-methylprop-2-enoyloxy)cyclohexyl]butanoate |
| SMILES | C=C(C)C(=O)OC1(C(O)CCC(=O)OCC(C)(F)F)CCCCC1 |
| InChI | InChI=1S/C17H26F2O5/c1-12(2)15(22)24-17(9-5-4-6-10-17)13(20)7-8-14(21)23-11-16(3,18)19/h13,20H,1,4-11H2,2-3H3 |
| InChIKey | WPUULVYMLOINFX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|