C17H22F6O4 — CID 118548747
[1,1,1,3,3,3-hexafluoro-2-[1-(2-methylprop-2-enoyloxy)cyclopentyl]propan-2-yl] 2,2-dimethylpropanoate (PubChem CID 118548747) has the molecular formula C17H22F6O4 and a molecular weight of 404.35 g/mol. Its IUPAC name is [1,1,1,3,3,3-hexafluoro-2-[1-(2-methylprop-2-enoyloxy)cyclopentyl]propan-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [1,1,1,3,3,3-hexafluoro-2-[1-(2-methylprop-2-enoyloxy)cyclopentyl]propan-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 118548747 |
| Molecular Formula | C17H22F6O4 |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | [1,1,1,3,3,3-hexafluoro-2-[1-(2-methylprop-2-enoyloxy)cyclopentyl]propan-2-yl] 2,2-dimethylpropanoate |
| SMILES | C=C(C)C(=O)OC1(C(OC(=O)C(C)(C)C)(C(F)(F)F)C(F)(F)F)CCCC1 |
| InChI | InChI=1S/C17H22F6O4/c1-10(2)11(24)26-14(8-6-7-9-14)15(16(18,19)20,17(21,22)23)27-12(25)13(3,4)5/h1,6-9H2,2-5H3 |
| InChIKey | KZZIJRODFDDNMF-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|