C17H23F6IO4 — CID 155096352
[1-[1,1,1,3,3,3-hexafluoro-2-(2-methylpropanoyloxy)propan-2-yl]cyclohexyl] 2-iodobutanoate (PubChem CID 155096352) has the molecular formula C17H23F6IO4 and a molecular weight of 532.26 g/mol. Its IUPAC name is [1-[1,1,1,3,3,3-hexafluoro-2-(2-methylpropanoyloxy)propan-2-yl]cyclohexyl] 2-iodobutanoate.
| Compound Name | [1-[1,1,1,3,3,3-hexafluoro-2-(2-methylpropanoyloxy)propan-2-yl]cyclohexyl] 2-iodobutanoate |
|---|---|
| PubChem CID | 155096352 |
| Molecular Formula | C17H23F6IO4 |
| Molecular Weight | 532.26 g/mol |
| Exact Mass | 532.05 |
| IUPAC Name | [1-[1,1,1,3,3,3-hexafluoro-2-(2-methylpropanoyloxy)propan-2-yl]cyclohexyl] 2-iodobutanoate |
| SMILES | CCC(I)C(=O)OC1(C(OC(=O)C(C)C)(C(F)(F)F)C(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C17H23F6IO4/c1-4-11(24)13(26)27-14(8-6-5-7-9-14)15(16(18,19)20,17(21,22)23)28-12(25)10(2)3/h10-11H,4-9H2,1-3H3 |
| InChIKey | WSCSTSJLPFKFRY-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.26 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|