C18H23F6IO4 — CID 155096358
[2-[1,1,1,3,3,3-hexafluoro-2-(2-methylpropanoyloxy)propan-2-yl]-2-bicyclo[2.2.1]heptanyl] 2-iodobutanoate (PubChem CID 155096358) has the molecular formula C18H23F6IO4 and a molecular weight of 544.27 g/mol. Its IUPAC name is [2-[1,1,1,3,3,3-hexafluoro-2-(2-methylpropanoyloxy)propan-2-yl]-2-bicyclo[2.2.1]heptanyl] 2-iodobutanoate.
| Compound Name | [2-[1,1,1,3,3,3-hexafluoro-2-(2-methylpropanoyloxy)propan-2-yl]-2-bicyclo[2.2.1]heptanyl] 2-iodobutanoate |
|---|---|
| PubChem CID | 155096358 |
| Molecular Formula | C18H23F6IO4 |
| Molecular Weight | 544.27 g/mol |
| Exact Mass | 544.05 |
| IUPAC Name | [2-[1,1,1,3,3,3-hexafluoro-2-(2-methylpropanoyloxy)propan-2-yl]-2-bicyclo[2.2.1]heptanyl] 2-iodobutanoate |
| SMILES | CCC(I)C(=O)OC1(C(OC(=O)C(C)C)(C(F)(F)F)C(F)(F)F)CC2CCC1C2 |
| InChI | InChI=1S/C18H23F6IO4/c1-4-12(25)14(27)28-15(8-10-5-6-11(15)7-10)16(17(19,20)21,18(22,23)24)29-13(26)9(2)3/h9-12H,4-8H2,1-3H3 |
| InChIKey | WYBNGTRXGVIJDU-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.27 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|