C14H21IO5 — CID 129121576
(3,5,7-trihydroxy-1-adamantyl) 2-iodobutanoate (PubChem CID 129121576) has the molecular formula C14H21IO5 and a molecular weight of 396.22 g/mol. Its IUPAC name is (3,5,7-trihydroxy-1-adamantyl) 2-iodobutanoate.
| Compound Name | (3,5,7-trihydroxy-1-adamantyl) 2-iodobutanoate |
|---|---|
| PubChem CID | 129121576 |
| Molecular Formula | C14H21IO5 |
| Molecular Weight | 396.22 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | (3,5,7-trihydroxy-1-adamantyl) 2-iodobutanoate |
| SMILES | CCC(I)C(=O)OC12CC3(O)CC(O)(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C14H21IO5/c1-2-9(15)10(16)20-14-6-11(17)3-12(18,7-14)5-13(19,4-11)8-14/h9,17-19H,2-8H2,1H3 |
| InChIKey | IMLDAWMGBKARNM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.22 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|