C23H39IO5 — CID 130411685
[3,5,7-tris(2-hydroxypropan-2-yl)-1-adamantyl] 2-iodobutanoate (PubChem CID 130411685) has the molecular formula C23H39IO5 and a molecular weight of 522.46 g/mol. Its IUPAC name is [3,5,7-tris(2-hydroxypropan-2-yl)-1-adamantyl] 2-iodobutanoate.
| Compound Name | [3,5,7-tris(2-hydroxypropan-2-yl)-1-adamantyl] 2-iodobutanoate |
|---|---|
| PubChem CID | 130411685 |
| Molecular Formula | C23H39IO5 |
| Molecular Weight | 522.46 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | [3,5,7-tris(2-hydroxypropan-2-yl)-1-adamantyl] 2-iodobutanoate |
| SMILES | CCC(I)C(=O)OC12CC3(C(C)(C)O)CC(C(C)(C)O)(C1)CC(C(C)(C)O)(C2)C3 |
| InChI | InChI=1S/C23H39IO5/c1-8-15(24)16(25)29-23-12-20(17(2,3)26)9-21(13-23,18(4,5)27)11-22(10-20,14-23)19(6,7)28/h15,26-28H,8-14H2,1-7H3 |
| InChIKey | APBFCPOXMJZNPS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|