About 2-cyclohexylbutan-2-yl 2-iodobutanoate
2-cyclohexylbutan-2-yl 2-iodobutanoate (PubChem CID 134565455) has the molecular formula C14H25IO2
and a molecular weight of 352.26 g/mol. Its IUPAC name is 2-cyclohexylbutan-2-yl 2-iodobutanoate.
Molecular Properties
| Compound Name | 2-cyclohexylbutan-2-yl 2-iodobutanoate |
| PubChem CID | 134565455 |
| Molecular Formula | C14H25IO2 |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 2-cyclohexylbutan-2-yl 2-iodobutanoate |
| SMILES | CCC(I)C(=O)OC(C)(CC)C1CCCCC1 |
| InChI | InChI=1S/C14H25IO2/c1-4-12(15)13(16)17-14(3,5-2)11-9-7-6-8-10-11/h11-12H,4-10H2,1-3H3 |
| InChIKey | IUUWZUCDOIAQJZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexylbutan-2-yl 2-iodobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexylbutan-2-yl 2-iodobutanoate?
The IUPAC name of 2-cyclohexylbutan-2-yl 2-iodobutanoate (CID 134565455) is 2-cyclohexylbutan-2-yl 2-iodobutanoate.
What is the SMILES notation for 2-cyclohexylbutan-2-yl 2-iodobutanoate?
The canonical SMILES for 2-cyclohexylbutan-2-yl 2-iodobutanoate is CCC(I)C(=O)OC(C)(CC)C1CCCCC1.
What is the InChIKey of 2-cyclohexylbutan-2-yl 2-iodobutanoate?
The InChIKey is IUUWZUCDOIAQJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25IO2/c1-4-12(15)13(16)17-14(3,5-2)11-9-7-6-8-10-11/h11-12H,4-10H2,1-3H3.
What are the key properties of 2-cyclohexylbutan-2-yl 2-iodobutanoate?
2-cyclohexylbutan-2-yl 2-iodobutanoate has a molecular weight of 352.26 g/mol, XLogP of 4.49, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexylbutan-2-yl 2-iodobutanoate is sourced from PubChem (CID 134565455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).