About 2-cyclohexylbutan-2-yl methylsulfanylformate
2-cyclohexylbutan-2-yl methylsulfanylformate (PubChem CID 91161671) has the molecular formula C12H22O2S
and a molecular weight of 230.37 g/mol. Its IUPAC name is 2-cyclohexylbutan-2-yl methylsulfanylformate.
Molecular Properties
| Compound Name | 2-cyclohexylbutan-2-yl methylsulfanylformate |
| PubChem CID | 91161671 |
| Molecular Formula | C12H22O2S |
| Molecular Weight | 230.37 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 2-cyclohexylbutan-2-yl methylsulfanylformate |
| SMILES | CCC(C)(OC(=O)SC)C1CCCCC1 |
| InChI | InChI=1S/C12H22O2S/c1-4-12(2,14-11(13)15-3)10-8-6-5-7-9-10/h10H,4-9H2,1-3H3 |
| InChIKey | PXMWUHYYPZOJKV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexylbutan-2-yl methylsulfanylformate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexylbutan-2-yl methylsulfanylformate?
The IUPAC name of 2-cyclohexylbutan-2-yl methylsulfanylformate (CID 91161671) is 2-cyclohexylbutan-2-yl methylsulfanylformate.
What is the SMILES notation for 2-cyclohexylbutan-2-yl methylsulfanylformate?
The canonical SMILES for 2-cyclohexylbutan-2-yl methylsulfanylformate is CCC(C)(OC(=O)SC)C1CCCCC1.
What is the InChIKey of 2-cyclohexylbutan-2-yl methylsulfanylformate?
The InChIKey is PXMWUHYYPZOJKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2S/c1-4-12(2,14-11(13)15-3)10-8-6-5-7-9-10/h10H,4-9H2,1-3H3.
What are the key properties of 2-cyclohexylbutan-2-yl methylsulfanylformate?
2-cyclohexylbutan-2-yl methylsulfanylformate has a molecular weight of 230.37 g/mol, XLogP of 4.24, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexylbutan-2-yl methylsulfanylformate is sourced from PubChem (CID 91161671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).