About 2-cyclopentylbutan-2-yl 2-methylpropanoate
2-cyclopentylbutan-2-yl 2-methylpropanoate (PubChem CID 59782925) has the molecular formula C13H24O2
and a molecular weight of 212.33 g/mol. Its IUPAC name is 2-cyclopentylbutan-2-yl 2-methylpropanoate.
Molecular Properties
| Compound Name | 2-cyclopentylbutan-2-yl 2-methylpropanoate |
| PubChem CID | 59782925 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 2-cyclopentylbutan-2-yl 2-methylpropanoate |
| SMILES | CCC(C)(OC(=O)C(C)C)C1CCCC1 |
| InChI | InChI=1S/C13H24O2/c1-5-13(4,11-8-6-7-9-11)15-12(14)10(2)3/h10-11H,5-9H2,1-4H3 |
| InChIKey | XCRLRMNLCHGVAD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclopentylbutan-2-yl 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentylbutan-2-yl 2-methylpropanoate?
The IUPAC name of 2-cyclopentylbutan-2-yl 2-methylpropanoate (CID 59782925) is 2-cyclopentylbutan-2-yl 2-methylpropanoate.
What is the SMILES notation for 2-cyclopentylbutan-2-yl 2-methylpropanoate?
The canonical SMILES for 2-cyclopentylbutan-2-yl 2-methylpropanoate is CCC(C)(OC(=O)C(C)C)C1CCCC1.
What is the InChIKey of 2-cyclopentylbutan-2-yl 2-methylpropanoate?
The InChIKey is XCRLRMNLCHGVAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O2/c1-5-13(4,11-8-6-7-9-11)15-12(14)10(2)3/h10-11H,5-9H2,1-4H3.
What are the key properties of 2-cyclopentylbutan-2-yl 2-methylpropanoate?
2-cyclopentylbutan-2-yl 2-methylpropanoate has a molecular weight of 212.33 g/mol, XLogP of 3.54, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentylbutan-2-yl 2-methylpropanoate is sourced from PubChem (CID 59782925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).