C14H21IO4 — CID 146965924
(3,7-dihydroxy-7-methyl-5-tricyclo[3.3.1.01,3]nonanyl) 2-iodobutanoate (PubChem CID 146965924) has the molecular formula C14H21IO4 and a molecular weight of 380.22 g/mol. Its IUPAC name is (3,7-dihydroxy-7-methyl-5-tricyclo[3.3.1.01,3]nonanyl) 2-iodobutanoate.
| Compound Name | (3,7-dihydroxy-7-methyl-5-tricyclo[3.3.1.01,3]nonanyl) 2-iodobutanoate |
|---|---|
| PubChem CID | 146965924 |
| Molecular Formula | C14H21IO4 |
| Molecular Weight | 380.22 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | (3,7-dihydroxy-7-methyl-5-tricyclo[3.3.1.01,3]nonanyl) 2-iodobutanoate |
| SMILES | CCC(I)C(=O)OC12CC(C)(O)CC3(C1)CC3(O)C2 |
| InChI | InChI=1S/C14H21IO4/c1-3-9(15)10(16)19-13-5-11(2,17)4-12(6-13)7-14(12,18)8-13/h9,17-18H,3-8H2,1-2H3 |
| InChIKey | ALMOVSCNXWRWOB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.22 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|