(3,7-dihydroxy-7-methyl-5-tricyclo[3.3.1.01,3]nonanyl) 2-iodobutanoate

C14H21IO4 — CID 146965924

IUPAC(3,7-dihydroxy-7-methyl-5-tricyclo[3.3.1.01,3]nonanyl) 2-iodobutanoate
SMILESCCC(I)C(=O)OC12CC(C)(O)CC3(C1)CC3(O)C2
InChIInChI=1S/C14H21IO4/c1-3-9(15)10(16)19-13-5-11(2,17)4-12(6-13)7-14(12,18)8-13/h9,17-18H,3-8H2,1-2H3
InChIKeyALMOVSCNXWRWOB-UHFFFAOYSA-N
MW380.22 g/mol
LogP1.94
Rot. Bonds3

About (3,7-dihydroxy-7-methyl-5-tricyclo[3.3.1.01,3]nonanyl) 2-iodobutanoate

(3,7-dihydroxy-7-methyl-5-tricyclo[3.3.1.01,3]nonanyl) 2-iodobutanoate (PubChem CID 146965924) has the molecular formula C14H21IO4 and a molecular weight of 380.22 g/mol. Its IUPAC name is (3,7-dihydroxy-7-methyl-5-tricyclo[3.3.1.01,3]nonanyl) 2-iodobutanoate.

Molecular Properties

Compound Name(3,7-dihydroxy-7-methyl-5-tricyclo[3.3.1.01,3]nonanyl) 2-iodobutanoate
PubChem CID146965924
Molecular FormulaC14H21IO4
Molecular Weight380.22 g/mol
Exact Mass380.05
IUPAC Name(3,7-dihydroxy-7-methyl-5-tricyclo[3.3.1.01,3]nonanyl) 2-iodobutanoate
SMILESCCC(I)C(=O)OC12CC(C)(O)CC3(C1)CC3(O)C2
InChIInChI=1S/C14H21IO4/c1-3-9(15)10(16)19-13-5-11(2,17)4-12(6-13)7-14(12,18)8-13/h9,17-18H,3-8H2,1-2H3
InChIKeyALMOVSCNXWRWOB-UHFFFAOYSA-N
XLogP1.94
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500380.22
LogP ≤ 51.94
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze (3,7-dihydroxy-7-methyl-5-tricyclo[3.3.1.01,3]nonanyl) 2-iodobutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3,7-dihydroxy-7-methyl-5-tricyclo[3.3.1.01,3]nonanyl) 2-iodobutanoate?
The IUPAC name of (3,7-dihydroxy-7-methyl-5-tricyclo[3.3.1.01,3]nonanyl) 2-iodobutanoate (CID 146965924) is (3,7-dihydroxy-7-methyl-5-tricyclo[3.3.1.01,3]nonanyl) 2-iodobutanoate.
What is the SMILES notation for (3,7-dihydroxy-7-methyl-5-tricyclo[3.3.1.01,3]nonanyl) 2-iodobutanoate?
The canonical SMILES for (3,7-dihydroxy-7-methyl-5-tricyclo[3.3.1.01,3]nonanyl) 2-iodobutanoate is CCC(I)C(=O)OC12CC(C)(O)CC3(C1)CC3(O)C2.
What is the InChIKey of (3,7-dihydroxy-7-methyl-5-tricyclo[3.3.1.01,3]nonanyl) 2-iodobutanoate?
The InChIKey is ALMOVSCNXWRWOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21IO4/c1-3-9(15)10(16)19-13-5-11(2,17)4-12(6-13)7-14(12,18)8-13/h9,17-18H,3-8H2,1-2H3.
What are the key properties of (3,7-dihydroxy-7-methyl-5-tricyclo[3.3.1.01,3]nonanyl) 2-iodobutanoate?
(3,7-dihydroxy-7-methyl-5-tricyclo[3.3.1.01,3]nonanyl) 2-iodobutanoate has a molecular weight of 380.22 g/mol, XLogP of 1.94, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,7-dihydroxy-7-methyl-5-tricyclo[3.3.1.01,3]nonanyl) 2-iodobutanoate is sourced from PubChem (CID 146965924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).