About (1,8-dihydroxy-3-tricyclo[4.3.1.13,8]undecanyl) 2-methylbutanoate
(1,8-dihydroxy-3-tricyclo[4.3.1.13,8]undecanyl) 2-methylbutanoate (PubChem CID 20752223) has the molecular formula C16H26O4
and a molecular weight of 282.38 g/mol. Its IUPAC name is (1,8-dihydroxy-3-tricyclo[4.3.1.13,8]undecanyl) 2-methylbutanoate.
Analyze (1,8-dihydroxy-3-tricyclo[4.3.1.13,8]undecanyl) 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,8-dihydroxy-3-tricyclo[4.3.1.13,8]undecanyl) 2-methylbutanoate?
The IUPAC name of (1,8-dihydroxy-3-tricyclo[4.3.1.13,8]undecanyl) 2-methylbutanoate (CID 20752223) is (1,8-dihydroxy-3-tricyclo[4.3.1.13,8]undecanyl) 2-methylbutanoate.
What is the SMILES notation for (1,8-dihydroxy-3-tricyclo[4.3.1.13,8]undecanyl) 2-methylbutanoate?
The canonical SMILES for (1,8-dihydroxy-3-tricyclo[4.3.1.13,8]undecanyl) 2-methylbutanoate is CCC(C)C(=O)OC12CCC3CC(O)(CC(O)(C3)C1)C2.
What is the InChIKey of (1,8-dihydroxy-3-tricyclo[4.3.1.13,8]undecanyl) 2-methylbutanoate?
The InChIKey is BQJCFWZFFCVLJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O4/c1-3-11(2)13(17)20-16-5-4-12-6-14(18,9-16)8-15(19,7-12)10-16/h11-12,18-19H,3-10H2,1-2H3.
What are the key properties of (1,8-dihydroxy-3-tricyclo[4.3.1.13,8]undecanyl) 2-methylbutanoate?
(1,8-dihydroxy-3-tricyclo[4.3.1.13,8]undecanyl) 2-methylbutanoate has a molecular weight of 282.38 g/mol, XLogP of 2.16, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1,8-dihydroxy-3-tricyclo[4.3.1.13,8]undecanyl) 2-methylbutanoate is sourced from PubChem (CID 20752223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).