C16H26O4 — CID 58975850
(3-hydroxy-5-methoxy-1-adamantyl) 2-methylbutanoate (PubChem CID 58975850) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is (3-hydroxy-5-methoxy-1-adamantyl) 2-methylbutanoate.
| Compound Name | (3-hydroxy-5-methoxy-1-adamantyl) 2-methylbutanoate |
|---|---|
| PubChem CID | 58975850 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | (3-hydroxy-5-methoxy-1-adamantyl) 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC12CC3CC(O)(CC(OC)(C3)C1)C2 |
| InChI | InChI=1S/C16H26O4/c1-4-11(2)13(17)20-16-7-12-5-14(18,9-16)8-15(6-12,10-16)19-3/h11-12,18H,4-10H2,1-3H3 |
| InChIKey | ILZVGCAXPYBCRD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |