C20H28F6O4 — CID 122663952
[2-[1,1,1,3,3,3-hexafluoro-2-(2-methylpropanoyloxy)propan-2-yl]-2-bicyclo[2.2.1]heptanyl] 2,2-dimethylbutanoate (PubChem CID 122663952) has the molecular formula C20H28F6O4 and a molecular weight of 446.43 g/mol. Its IUPAC name is [2-[1,1,1,3,3,3-hexafluoro-2-(2-methylpropanoyloxy)propan-2-yl]-2-bicyclo[2.2.1]heptanyl] 2,2-dimethylbutanoate.
| Compound Name | [2-[1,1,1,3,3,3-hexafluoro-2-(2-methylpropanoyloxy)propan-2-yl]-2-bicyclo[2.2.1]heptanyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 122663952 |
| Molecular Formula | C20H28F6O4 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | [2-[1,1,1,3,3,3-hexafluoro-2-(2-methylpropanoyloxy)propan-2-yl]-2-bicyclo[2.2.1]heptanyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1(C(OC(=O)C(C)C)(C(F)(F)F)C(F)(F)F)CC2CCC1C2 |
| InChI | InChI=1S/C20H28F6O4/c1-6-16(4,5)15(28)30-17(10-12-7-8-13(17)9-12)18(19(21,22)23,20(24,25)26)29-14(27)11(2)3/h11-13H,6-10H2,1-5H3 |
| InChIKey | GSLVQHRFPRHJHF-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |