C16H30O2 — CID 122644606
[1-(3-methylpentan-3-yl)cyclopentyl] 2-methylbutanoate (PubChem CID 122644606) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is [1-(3-methylpentan-3-yl)cyclopentyl] 2-methylbutanoate.
| Compound Name | [1-(3-methylpentan-3-yl)cyclopentyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 122644606 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | [1-(3-methylpentan-3-yl)cyclopentyl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1(C(C)(CC)CC)CCCC1 |
| InChI | InChI=1S/C16H30O2/c1-6-13(4)14(17)18-16(11-9-10-12-16)15(5,7-2)8-3/h13H,6-12H2,1-5H3 |
| InChIKey | BWQDZYLJQJGJRX-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |