About (1-ethylcyclopentyl) 2-methylbutanoate;2,2,2-trifluoroethyl 2-methylbutanoate
(1-ethylcyclopentyl) 2-methylbutanoate;2,2,2-trifluoroethyl 2-methylbutanoate (PubChem CID 163540697) has the molecular formula C19H33F3O4
and a molecular weight of 382.46 g/mol. Its IUPAC name is (1-ethylcyclopentyl) 2-methylbutanoate;2,2,2-trifluoroethyl 2-methylbutanoate.
Molecular Properties
| Compound Name | (1-ethylcyclopentyl) 2-methylbutanoate;2,2,2-trifluoroethyl 2-methylbutanoate |
| PubChem CID | 163540697 |
| Molecular Formula | C19H33F3O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | (1-ethylcyclopentyl) 2-methylbutanoate;2,2,2-trifluoroethyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1(CC)CCCC1.CCC(C)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C12H22O2.C7H11F3O2/c1-4-10(3)11(13)14-12(5-2)8-6-7-9-12;1-3-5(2)6(11)12-4-7(8,9)10/h10H,4-9H2,1-3H3;5H,3-4H2,1-2H3 |
| InChIKey | FAVZMAOHGHYODV-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-ethylcyclopentyl) 2-methylbutanoate;2,2,2-trifluoroethyl 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylcyclopentyl) 2-methylbutanoate;2,2,2-trifluoroethyl 2-methylbutanoate?
The IUPAC name of (1-ethylcyclopentyl) 2-methylbutanoate;2,2,2-trifluoroethyl 2-methylbutanoate (CID 163540697) is (1-ethylcyclopentyl) 2-methylbutanoate;2,2,2-trifluoroethyl 2-methylbutanoate.
What is the SMILES notation for (1-ethylcyclopentyl) 2-methylbutanoate;2,2,2-trifluoroethyl 2-methylbutanoate?
The canonical SMILES for (1-ethylcyclopentyl) 2-methylbutanoate;2,2,2-trifluoroethyl 2-methylbutanoate is CCC(C)C(=O)OC1(CC)CCCC1.CCC(C)C(=O)OCC(F)(F)F.
What is the InChIKey of (1-ethylcyclopentyl) 2-methylbutanoate;2,2,2-trifluoroethyl 2-methylbutanoate?
The InChIKey is FAVZMAOHGHYODV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2.C7H11F3O2/c1-4-10(3)11(13)14-12(5-2)8-6-7-9-12;1-3-5(2)6(11)12-4-7(8,9)10/h10H,4-9H2,1-3H3;5H,3-4H2,1-2H3.
What are the key properties of (1-ethylcyclopentyl) 2-methylbutanoate;2,2,2-trifluoroethyl 2-methylbutanoate?
(1-ethylcyclopentyl) 2-methylbutanoate;2,2,2-trifluoroethyl 2-methylbutanoate has a molecular weight of 382.46 g/mol, XLogP of 5.44, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylcyclopentyl) 2-methylbutanoate;2,2,2-trifluoroethyl 2-methylbutanoate is sourced from PubChem (CID 163540697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).