C22H33F3O6 — CID 170852401
(1-ethylcyclooctyl) 2-methylprop-2-enoate;[2-oxo-2-(2,2,2-trifluoroethoxy)ethyl] 2-methylprop-2-enoate (PubChem CID 170852401) has the molecular formula C22H33F3O6 and a molecular weight of 450.49 g/mol. Its IUPAC name is (1-ethylcyclooctyl) 2-methylprop-2-enoate;[2-oxo-2-(2,2,2-trifluoroethoxy)ethyl] 2-methylprop-2-enoate.
| Compound Name | (1-ethylcyclooctyl) 2-methylprop-2-enoate;[2-oxo-2-(2,2,2-trifluoroethoxy)ethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 170852401 |
| Molecular Formula | C22H33F3O6 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | (1-ethylcyclooctyl) 2-methylprop-2-enoate;[2-oxo-2-(2,2,2-trifluoroethoxy)ethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(CC)CCCCCCC1.C=C(C)C(=O)OCC(=O)OCC(F)(F)F |
| InChI | InChI=1S/C14H24O2.C8H9F3O4/c1-4-14(16-13(15)12(2)3)10-8-6-5-7-9-11-14;1-5(2)7(13)14-3-6(12)15-4-8(9,10)11/h2,4-11H2,1,3H3;1,3-4H2,2H3 |
| InChIKey | WFJOYYCNCGLACO-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|