C13H17F5O2 — CID 90250893
[1-(3,3,4,4,4-pentafluorobutyl)cyclopentyl] 2-methylprop-2-enoate (PubChem CID 90250893) has the molecular formula C13H17F5O2 and a molecular weight of 300.27 g/mol. Its IUPAC name is [1-(3,3,4,4,4-pentafluorobutyl)cyclopentyl] 2-methylprop-2-enoate.
| Compound Name | [1-(3,3,4,4,4-pentafluorobutyl)cyclopentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 90250893 |
| Molecular Formula | C13H17F5O2 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | [1-(3,3,4,4,4-pentafluorobutyl)cyclopentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(CCC(F)(F)C(F)(F)F)CCCC1 |
| InChI | InChI=1S/C13H17F5O2/c1-9(2)10(19)20-11(5-3-4-6-11)7-8-12(14,15)13(16,17)18/h1,3-8H2,2H3 |
| InChIKey | BJYGKYMZGIGZHS-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|