C18H26F6O3 — CID 89107808
[1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclopentyl] (Z)-2,7-dimethyloct-4-enoate (PubChem CID 89107808) has the molecular formula C18H26F6O3 and a molecular weight of 404.39 g/mol. Its IUPAC name is [1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclopentyl] (Z)-2,7-dimethyloct-4-enoate.
| Compound Name | [1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclopentyl] (Z)-2,7-dimethyloct-4-enoate |
|---|---|
| PubChem CID | 89107808 |
| Molecular Formula | C18H26F6O3 |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | [1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclopentyl] (Z)-2,7-dimethyloct-4-enoate |
| SMILES | CC(C)C/C=C\CC(C)C(=O)OC1(C(O)(C(F)(F)F)C(F)(F)F)CCCC1 |
| InChI | InChI=1S/C18H26F6O3/c1-12(2)8-4-5-9-13(3)14(25)27-15(10-6-7-11-15)16(26,17(19,20)21)18(22,23)24/h4-5,12-13,26H,6-11H2,1-3H3/b5-4- |
| InChIKey | QSNAWHDXCZPWGO-PLNGDYQASA-N |
| XLogP | 5.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|