C19H26F8O2 — CID 58995519
[1-[1,1-difluoro-2-methyl-2-(trifluoromethyl)heptyl]cyclohexyl] 2-(trifluoromethyl)prop-2-enoate (PubChem CID 58995519) has the molecular formula C19H26F8O2 and a molecular weight of 438.40 g/mol. Its IUPAC name is [1-[1,1-difluoro-2-methyl-2-(trifluoromethyl)heptyl]cyclohexyl] 2-(trifluoromethyl)prop-2-enoate.
| Compound Name | [1-[1,1-difluoro-2-methyl-2-(trifluoromethyl)heptyl]cyclohexyl] 2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 58995519 |
| Molecular Formula | C19H26F8O2 |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | [1-[1,1-difluoro-2-methyl-2-(trifluoromethyl)heptyl]cyclohexyl] 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OC1(C(F)(F)C(C)(CCCCC)C(F)(F)F)CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C19H26F8O2/c1-4-5-7-10-15(3,19(25,26)27)18(23,24)16(11-8-6-9-12-16)29-14(28)13(2)17(20,21)22/h2,4-12H2,1,3H3 |
| InChIKey | PZMWTRUDHKPBCL-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|