C15H22F5NO6S2 — CID 170265418
3-(3-bicyclo[3.3.1]nonanyl)propyl 2,2-difluoro-2-(trifluoromethylsulfonylsulfamoyl)acetate (PubChem CID 170265418) has the molecular formula C15H22F5NO6S2 and a molecular weight of 471.47 g/mol. Its IUPAC name is 3-(3-bicyclo[3.3.1]nonanyl)propyl 2,2-difluoro-2-(trifluoromethylsulfonylsulfamoyl)acetate.
| Compound Name | 3-(3-bicyclo[3.3.1]nonanyl)propyl 2,2-difluoro-2-(trifluoromethylsulfonylsulfamoyl)acetate |
|---|---|
| PubChem CID | 170265418 |
| Molecular Formula | C15H22F5NO6S2 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | 3-(3-bicyclo[3.3.1]nonanyl)propyl 2,2-difluoro-2-(trifluoromethylsulfonylsulfamoyl)acetate |
| SMILES | O=C(OCCCC1CC2CCCC(C1)C2)C(F)(F)S(=O)(=O)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C15H22F5NO6S2/c16-14(17,28(23,24)21-29(25,26)15(18,19)20)13(22)27-6-2-5-12-8-10-3-1-4-11(7-10)9-12/h10-12,21H,1-9H2 |
| InChIKey | VBPSNWGPJBGFFF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|