C16H26F3NO2S — CID 129082408
2-(trifluoromethylsulfanylamino)propyl 3-(3-bicyclo[3.3.1]nonanyl)propanoate (PubChem CID 129082408) has the molecular formula C16H26F3NO2S and a molecular weight of 353.45 g/mol. Its IUPAC name is 2-(trifluoromethylsulfanylamino)propyl 3-(3-bicyclo[3.3.1]nonanyl)propanoate.
| Compound Name | 2-(trifluoromethylsulfanylamino)propyl 3-(3-bicyclo[3.3.1]nonanyl)propanoate |
|---|---|
| PubChem CID | 129082408 |
| Molecular Formula | C16H26F3NO2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 2-(trifluoromethylsulfanylamino)propyl 3-(3-bicyclo[3.3.1]nonanyl)propanoate |
| SMILES | CC(COC(=O)CCC1CC2CCCC(C2)C1)NSC(F)(F)F |
| InChI | InChI=1S/C16H26F3NO2S/c1-11(20-23-16(17,18)19)10-22-15(21)6-5-14-8-12-3-2-4-13(7-12)9-14/h11-14,20H,2-10H2,1H3 |
| InChIKey | WHNFAYBHPTZGJK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|