C20H33F3O2 — CID 146948820
(5,5,6-trifluoro-6-methylheptyl) 3-(3-bicyclo[3.3.1]nonanyl)propanoate (PubChem CID 146948820) has the molecular formula C20H33F3O2 and a molecular weight of 362.48 g/mol. Its IUPAC name is (5,5,6-trifluoro-6-methylheptyl) 3-(3-bicyclo[3.3.1]nonanyl)propanoate.
| Compound Name | (5,5,6-trifluoro-6-methylheptyl) 3-(3-bicyclo[3.3.1]nonanyl)propanoate |
|---|---|
| PubChem CID | 146948820 |
| Molecular Formula | C20H33F3O2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | (5,5,6-trifluoro-6-methylheptyl) 3-(3-bicyclo[3.3.1]nonanyl)propanoate |
| SMILES | CC(C)(F)C(F)(F)CCCCOC(=O)CCC1CC2CCCC(C2)C1 |
| InChI | InChI=1S/C20H33F3O2/c1-19(2,21)20(22,23)10-3-4-11-25-18(24)9-8-17-13-15-6-5-7-16(12-15)14-17/h15-17H,3-14H2,1-2H3 |
| InChIKey | AIIBLKTYAXSRHB-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|