C42H78O6 — CID 156758329
7-methyloctyl 3-[3,5-bis[3-(7-methyloctoxy)-3-oxopropyl]cyclohexyl]propanoate (PubChem CID 156758329) has the molecular formula C42H78O6 and a molecular weight of 679.08 g/mol. Its IUPAC name is 7-methyloctyl 3-[3,5-bis[3-(7-methyloctoxy)-3-oxopropyl]cyclohexyl]propanoate.
| Compound Name | 7-methyloctyl 3-[3,5-bis[3-(7-methyloctoxy)-3-oxopropyl]cyclohexyl]propanoate |
|---|---|
| PubChem CID | 156758329 |
| Molecular Formula | C42H78O6 |
| Molecular Weight | 679.08 g/mol |
| Exact Mass | 678.58 |
| IUPAC Name | 7-methyloctyl 3-[3,5-bis[3-(7-methyloctoxy)-3-oxopropyl]cyclohexyl]propanoate |
| SMILES | CC(C)CCCCCCOC(=O)CCC1CC(CCC(=O)OCCCCCCC(C)C)CC(CCC(=O)OCCCCCCC(C)C)C1 |
| InChI | InChI=1S/C42H78O6/c1-34(2)19-13-7-10-16-28-46-40(43)25-22-37-31-38(23-26-41(44)47-29-17-11-8-14-20-35(3)4)33-39(32-37)24-27-42(45)48-30-18-12-9-15-21-36(5)6/h34-39H,7-33H2,1-6H3 |
| InChIKey | SLVOWZHSCLFEMV-UHFFFAOYSA-N |
| XLogP | 11.81 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.08 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|