About 2-cyclopropylethyl 3-(propan-2-ylamino)propanoate
2-cyclopropylethyl 3-(propan-2-ylamino)propanoate (PubChem CID 106202501) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is 2-cyclopropylethyl 3-(propan-2-ylamino)propanoate.
Molecular Properties
| Compound Name | 2-cyclopropylethyl 3-(propan-2-ylamino)propanoate |
| PubChem CID | 106202501 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 2-cyclopropylethyl 3-(propan-2-ylamino)propanoate |
| SMILES | CC(C)NCCC(=O)OCCC1CC1 |
| InChI | InChI=1S/C11H21NO2/c1-9(2)12-7-5-11(13)14-8-6-10-3-4-10/h9-10,12H,3-8H2,1-2H3 |
| InChIKey | QUISUXQVGPDWBQ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopropylethyl 3-(propan-2-ylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropylethyl 3-(propan-2-ylamino)propanoate?
The IUPAC name of 2-cyclopropylethyl 3-(propan-2-ylamino)propanoate (CID 106202501) is 2-cyclopropylethyl 3-(propan-2-ylamino)propanoate.
What is the SMILES notation for 2-cyclopropylethyl 3-(propan-2-ylamino)propanoate?
The canonical SMILES for 2-cyclopropylethyl 3-(propan-2-ylamino)propanoate is CC(C)NCCC(=O)OCCC1CC1.
What is the InChIKey of 2-cyclopropylethyl 3-(propan-2-ylamino)propanoate?
The InChIKey is QUISUXQVGPDWBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2/c1-9(2)12-7-5-11(13)14-8-6-10-3-4-10/h9-10,12H,3-8H2,1-2H3.
What are the key properties of 2-cyclopropylethyl 3-(propan-2-ylamino)propanoate?
2-cyclopropylethyl 3-(propan-2-ylamino)propanoate has a molecular weight of 199.29 g/mol, XLogP of 1.72, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropylethyl 3-(propan-2-ylamino)propanoate is sourced from PubChem (CID 106202501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).