C14H21F6NO3S — CID 131979021
N-[2-(3-bicyclo[3.3.1]nonanyl)ethyl]-1,1,2,2,3,3-hexafluoro-3-hydroxypropane-1-sulfonamide (PubChem CID 131979021) has the molecular formula C14H21F6NO3S and a molecular weight of 397.38 g/mol. Its IUPAC name is N-[2-(3-bicyclo[3.3.1]nonanyl)ethyl]-1,1,2,2,3,3-hexafluoro-3-hydroxypropane-1-sulfonamide.
| Compound Name | N-[2-(3-bicyclo[3.3.1]nonanyl)ethyl]-1,1,2,2,3,3-hexafluoro-3-hydroxypropane-1-sulfonamide |
|---|---|
| PubChem CID | 131979021 |
| Molecular Formula | C14H21F6NO3S |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | N-[2-(3-bicyclo[3.3.1]nonanyl)ethyl]-1,1,2,2,3,3-hexafluoro-3-hydroxypropane-1-sulfonamide |
| SMILES | O=S(=O)(NCCC1CC2CCCC(C2)C1)C(F)(F)C(F)(F)C(O)(F)F |
| InChI | InChI=1S/C14H21F6NO3S/c15-12(16,13(17,18)22)14(19,20)25(23,24)21-5-4-11-7-9-2-1-3-10(6-9)8-11/h9-11,21-22H,1-8H2 |
| InChIKey | RPRTXDHAFXPSLV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|