C23H32F2O9S — CID 89027582
[2-(1-ethylcyclohexyl)oxy-2-oxoethyl] 4-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxyadamantane-1-carboxylate (PubChem CID 89027582) has the molecular formula C23H32F2O9S and a molecular weight of 522.56 g/mol. Its IUPAC name is [2-(1-ethylcyclohexyl)oxy-2-oxoethyl] 4-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxyadamantane-1-carboxylate.
| Compound Name | [2-(1-ethylcyclohexyl)oxy-2-oxoethyl] 4-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 89027582 |
| Molecular Formula | C23H32F2O9S |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | [2-(1-ethylcyclohexyl)oxy-2-oxoethyl] 4-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxyadamantane-1-carboxylate |
| SMILES | CCC1(OC(=O)COC(=O)C23CC4CC(C2)C(OC(=O)C(F)(F)SOOO)C(C4)C3)CCCCC1 |
| InChI | InChI=1S/C23H32F2O9S/c1-2-22(6-4-3-5-7-22)32-17(26)13-30-19(27)21-10-14-8-15(11-21)18(16(9-14)12-21)31-20(28)23(24,25)35-34-33-29/h14-16,18,29H,2-13H2,1H3 |
| InChIKey | VYAZNZNDMRXTIH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|