C14H20F2O7S — CID 59814172
[2-oxo-2-[(2-propyl-2-bicyclo[2.2.1]heptanyl)oxy]ethyl] 2,2-difluoro-2-(trioxidanylsulfanyl)acetate (PubChem CID 59814172) has the molecular formula C14H20F2O7S and a molecular weight of 370.37 g/mol. Its IUPAC name is [2-oxo-2-[(2-propyl-2-bicyclo[2.2.1]heptanyl)oxy]ethyl] 2,2-difluoro-2-(trioxidanylsulfanyl)acetate.
| Compound Name | [2-oxo-2-[(2-propyl-2-bicyclo[2.2.1]heptanyl)oxy]ethyl] 2,2-difluoro-2-(trioxidanylsulfanyl)acetate |
|---|---|
| PubChem CID | 59814172 |
| Molecular Formula | C14H20F2O7S |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | [2-oxo-2-[(2-propyl-2-bicyclo[2.2.1]heptanyl)oxy]ethyl] 2,2-difluoro-2-(trioxidanylsulfanyl)acetate |
| SMILES | CCCC1(OC(=O)COC(=O)C(F)(F)SOOO)CC2CCC1C2 |
| InChI | InChI=1S/C14H20F2O7S/c1-2-5-13(7-9-3-4-10(13)6-9)21-11(17)8-20-12(18)14(15,16)24-23-22-19/h9-10,19H,2-8H2,1H3 |
| InChIKey | OEODFTMZLBXGAQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|