C17H23F6IO3 — CID 134565509
[6-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]-2-bicyclo[2.2.2]octanyl] 2-iodo-2-methylbutanoate (PubChem CID 134565509) has the molecular formula C17H23F6IO3 and a molecular weight of 516.26 g/mol. Its IUPAC name is [6-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]-2-bicyclo[2.2.2]octanyl] 2-iodo-2-methylbutanoate.
| Compound Name | [6-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]-2-bicyclo[2.2.2]octanyl] 2-iodo-2-methylbutanoate |
|---|---|
| PubChem CID | 134565509 |
| Molecular Formula | C17H23F6IO3 |
| Molecular Weight | 516.26 g/mol |
| Exact Mass | 516.06 |
| IUPAC Name | [6-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]-2-bicyclo[2.2.2]octanyl] 2-iodo-2-methylbutanoate |
| SMILES | CCC(C)(I)C(=O)OC1CC2CCC1C(CC(O)(C(F)(F)F)C(F)(F)F)C2 |
| InChI | InChI=1S/C17H23F6IO3/c1-3-14(2,24)13(25)27-12-7-9-4-5-11(12)10(6-9)8-15(26,16(18,19)20)17(21,22)23/h9-12,26H,3-8H2,1-2H3 |
| InChIKey | JNYYNHRXIRRMJG-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.26 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|