C13H19IO4S — CID 134565519
(4,4-dioxo-4λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) 2-iodo-2-methylbutanoate (PubChem CID 134565519) has the molecular formula C13H19IO4S and a molecular weight of 398.26 g/mol. Its IUPAC name is (4,4-dioxo-4λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) 2-iodo-2-methylbutanoate.
| Compound Name | (4,4-dioxo-4λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) 2-iodo-2-methylbutanoate |
|---|---|
| PubChem CID | 134565519 |
| Molecular Formula | C13H19IO4S |
| Molecular Weight | 398.26 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | (4,4-dioxo-4λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) 2-iodo-2-methylbutanoate |
| SMILES | CCC(C)(I)C(=O)OC1C2CC3C1CS(=O)(=O)C3C2 |
| InChI | InChI=1S/C13H19IO4S/c1-3-13(2,14)12(15)18-11-7-4-8-9(11)6-19(16,17)10(8)5-7/h7-11H,3-6H2,1-2H3 |
| InChIKey | XNUKKXSOUCFGDN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|