C11H13F3O3 — CID 166810420
(5,6,6-trifluoro-5-hydroxy-2-bicyclo[2.2.1]heptanyl)methyl prop-2-enoate (PubChem CID 166810420) has the molecular formula C11H13F3O3 and a molecular weight of 250.22 g/mol. Its IUPAC name is (5,6,6-trifluoro-5-hydroxy-2-bicyclo[2.2.1]heptanyl)methyl prop-2-enoate.
| Compound Name | (5,6,6-trifluoro-5-hydroxy-2-bicyclo[2.2.1]heptanyl)methyl prop-2-enoate |
|---|---|
| PubChem CID | 166810420 |
| Molecular Formula | C11H13F3O3 |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | (5,6,6-trifluoro-5-hydroxy-2-bicyclo[2.2.1]heptanyl)methyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1CC2CC1C(F)(F)C2(O)F |
| InChI | InChI=1S/C11H13F3O3/c1-2-9(15)17-5-6-3-7-4-8(6)10(12,13)11(7,14)16/h2,6-8,16H,1,3-5H2 |
| InChIKey | BDKNPRHGOILSFT-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|