C18H24O4 — CID 91104364
[3-(prop-2-enoyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl prop-2-enoate (PubChem CID 91104364) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is [3-(prop-2-enoyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl prop-2-enoate.
| Compound Name | [3-(prop-2-enoyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 91104364 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | [3-(prop-2-enoyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1CC2C3CCC(C3)C2C1COC(=O)C=C |
| InChI | InChI=1S/C18H24O4/c1-3-16(19)21-9-13-8-14-11-5-6-12(7-11)18(14)15(13)10-22-17(20)4-2/h3-4,11-15,18H,1-2,5-10H2 |
| InChIKey | AWNGMMWIGZYNAM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|