C9H11F3O3 — CID 151236845
[2-(trifluoromethoxy)cyclobutyl]methyl prop-2-enoate (PubChem CID 151236845) has the molecular formula C9H11F3O3 and a molecular weight of 224.18 g/mol. Its IUPAC name is [2-(trifluoromethoxy)cyclobutyl]methyl prop-2-enoate.
| Compound Name | [2-(trifluoromethoxy)cyclobutyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 151236845 |
| Molecular Formula | C9H11F3O3 |
| Molecular Weight | 224.18 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | [2-(trifluoromethoxy)cyclobutyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1CCC1OC(F)(F)F |
| InChI | InChI=1S/C9H11F3O3/c1-2-8(13)14-5-6-3-4-7(6)15-9(10,11)12/h2,6-7H,1,3-5H2 |
| InChIKey | NPLMGXOSVMAOOY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.18 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|