C19H21F3O6 — CID 177277249
[3-hydroxy-4-[2-[4-(trifluoromethoxy)phenyl]acetyl]oxycyclohexyl]methyl prop-2-enoate (PubChem CID 177277249) has the molecular formula C19H21F3O6 and a molecular weight of 402.37 g/mol. Its IUPAC name is [3-hydroxy-4-[2-[4-(trifluoromethoxy)phenyl]acetyl]oxycyclohexyl]methyl prop-2-enoate.
| Compound Name | [3-hydroxy-4-[2-[4-(trifluoromethoxy)phenyl]acetyl]oxycyclohexyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 177277249 |
| Molecular Formula | C19H21F3O6 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | [3-hydroxy-4-[2-[4-(trifluoromethoxy)phenyl]acetyl]oxycyclohexyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1CCC(OC(=O)Cc2ccc(OC(F)(F)F)cc2)C(O)C1 |
| InChI | InChI=1S/C19H21F3O6/c1-2-17(24)26-11-13-5-8-16(15(23)9-13)27-18(25)10-12-3-6-14(7-4-12)28-19(20,21)22/h2-4,6-7,13,15-16,23H,1,5,8-11H2 |
| InChIKey | AWNHHIIOFSGITL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|