C21H26O6 — CID 142290202
[3-hydroxy-4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxycyclohexyl]methyl 2-methylprop-2-enoate (PubChem CID 142290202) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is [3-hydroxy-4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxycyclohexyl]methyl 2-methylprop-2-enoate.
| Compound Name | [3-hydroxy-4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxycyclohexyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 142290202 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | [3-hydroxy-4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxycyclohexyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1CCC(OC(=O)/C=C/c2ccc(OC)cc2)C(O)C1 |
| InChI | InChI=1S/C21H26O6/c1-14(2)21(24)26-13-16-6-10-19(18(22)12-16)27-20(23)11-7-15-4-8-17(25-3)9-5-15/h4-5,7-9,11,16,18-19,22H,1,6,10,12-13H2,2-3H3/b11-7+ |
| InChIKey | ZQFBYKQZIMNSLE-YRNVUSSQSA-N |
| XLogP | 2.90 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|