C20H30O6 — CID 158251874
[3-hydroxy-4-(2-methylprop-2-enoyloxy)cyclohexyl]methyl 2-methylprop-2-enoate;3-methylbut-3-en-2-one (PubChem CID 158251874) has the molecular formula C20H30O6 and a molecular weight of 366.45 g/mol. Its IUPAC name is [3-hydroxy-4-(2-methylprop-2-enoyloxy)cyclohexyl]methyl 2-methylprop-2-enoate;3-methylbut-3-en-2-one.
| Compound Name | [3-hydroxy-4-(2-methylprop-2-enoyloxy)cyclohexyl]methyl 2-methylprop-2-enoate;3-methylbut-3-en-2-one |
|---|---|
| PubChem CID | 158251874 |
| Molecular Formula | C20H30O6 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | [3-hydroxy-4-(2-methylprop-2-enoyloxy)cyclohexyl]methyl 2-methylprop-2-enoate;3-methylbut-3-en-2-one |
| SMILES | C=C(C)C(=O)OCC1CCC(OC(=O)C(=C)C)C(O)C1.C=C(C)C(C)=O |
| InChI | InChI=1S/C15H22O5.C5H8O/c1-9(2)14(17)19-8-11-5-6-13(12(16)7-11)20-15(18)10(3)4;1-4(2)5(3)6/h11-13,16H,1,3,5-8H2,2,4H3;1H2,2-3H3 |
| InChIKey | GGUVCUBPXKRJLM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|