C18H21F3O5 — CID 177277238
[3-hydroxy-4-[4-(trifluoromethoxy)phenoxy]cyclohexyl]methyl 2-methylprop-2-enoate (PubChem CID 177277238) has the molecular formula C18H21F3O5 and a molecular weight of 374.36 g/mol. Its IUPAC name is [3-hydroxy-4-[4-(trifluoromethoxy)phenoxy]cyclohexyl]methyl 2-methylprop-2-enoate.
| Compound Name | [3-hydroxy-4-[4-(trifluoromethoxy)phenoxy]cyclohexyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 177277238 |
| Molecular Formula | C18H21F3O5 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | [3-hydroxy-4-[4-(trifluoromethoxy)phenoxy]cyclohexyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1CCC(Oc2ccc(OC(F)(F)F)cc2)C(O)C1 |
| InChI | InChI=1S/C18H21F3O5/c1-11(2)17(23)24-10-12-3-8-16(15(22)9-12)25-13-4-6-14(7-5-13)26-18(19,20)21/h4-7,12,15-16,22H,1,3,8-10H2,2H3 |
| InChIKey | POSOGJTVUAKHFH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|