C14H23NO3 — CID 58651922
[4-(acetamidomethyl)cyclohexyl]methyl 2-methylprop-2-enoate (PubChem CID 58651922) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is [4-(acetamidomethyl)cyclohexyl]methyl 2-methylprop-2-enoate.
| Compound Name | [4-(acetamidomethyl)cyclohexyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58651922 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | [4-(acetamidomethyl)cyclohexyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1CCC(CNC(C)=O)CC1 |
| InChI | InChI=1S/C14H23NO3/c1-10(2)14(17)18-9-13-6-4-12(5-7-13)8-15-11(3)16/h12-13H,1,4-9H2,2-3H3,(H,15,16) |
| InChIKey | OGAAUSSMBNPGIJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|