C16H24O6 — CID 102522152
(4-acetyloxy-3-hydroxycyclohexyl)methyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate (PubChem CID 102522152) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is (4-acetyloxy-3-hydroxycyclohexyl)methyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate.
| Compound Name | (4-acetyloxy-3-hydroxycyclohexyl)methyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 102522152 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (4-acetyloxy-3-hydroxycyclohexyl)methyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate |
| SMILES | CC(=O)OC1CCC(COC(=O)C2CCC3OC3C2)CC1O |
| InChI | InChI=1S/C16H24O6/c1-9(17)21-13-4-2-10(6-12(13)18)8-20-16(19)11-3-5-14-15(7-11)22-14/h10-15,18H,2-8H2,1H3 |
| InChIKey | NJCWTGKQBMISSF-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|